C33H31N3O6 — CID 162463661
[(E)-[(9-ethyl-6-nitrocarbazol-3-yl)-[4-(1-methoxypropan-2-yloxy)-2-methylphenyl]methylidene]amino] benzoate (PubChem CID 162463661) has the molecular formula C33H31N3O6 and a molecular weight of 565.63 g/mol. Its IUPAC name is [(E)-[(9-ethyl-6-nitrocarbazol-3-yl)-[4-(1-methoxypropan-2-yloxy)-2-methylphenyl]methylidene]amino] benzoate.
| Compound Name | [(E)-[(9-ethyl-6-nitrocarbazol-3-yl)-[4-(1-methoxypropan-2-yloxy)-2-methylphenyl]methylidene]amino] benzoate |
|---|---|
| PubChem CID | 162463661 |
| Molecular Formula | C33H31N3O6 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | [(E)-[(9-ethyl-6-nitrocarbazol-3-yl)-[4-(1-methoxypropan-2-yloxy)-2-methylphenyl]methylidene]amino] benzoate |
| SMILES | CCn1c2ccc(/C(=N\OC(=O)c3ccccc3)c3ccc(OC(C)COC)cc3C)cc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C33H31N3O6/c1-5-35-30-15-11-24(18-28(30)29-19-25(36(38)39)12-16-31(29)35)32(34-42-33(37)23-9-7-6-8-10-23)27-14-13-26(17-21(27)2)41-22(3)20-40-4/h6-19,22H,5,20H2,1-4H3/b34-32+ |
| InChIKey | DJFCVQKGJKWTTP-NWBJSICCSA-N |
| XLogP | 7.05 |
| TPSA | 105.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|