C46H46N4O14S2 — CID 172957898
1-O-(1-methoxypropan-2-yl) 6-O-[(E)-[(2E)-2-[6-(1-methoxypropan-2-yloxy)-6-oxohexanoyl]oxyimino-1,2-bis(8-nitrodibenzothiophen-2-yl)ethylidene]amino] hexanedioate (PubChem CID 172957898) has the molecular formula C46H46N4O14S2 and a molecular weight of 943.02 g/mol. Its IUPAC name is 1-O-(1-methoxypropan-2-yl) 6-O-[(E)-[(2E)-2-[6-(1-methoxypropan-2-yloxy)-6-oxohexanoyl]oxyimino-1,2-bis(8-nitrodibenzothiophen-2-yl)ethylidene]amino] hexanedioate.
| Compound Name | 1-O-(1-methoxypropan-2-yl) 6-O-[(E)-[(2E)-2-[6-(1-methoxypropan-2-yloxy)-6-oxohexanoyl]oxyimino-1,2-bis(8-nitrodibenzothiophen-2-yl)ethylidene]amino] hexanedioate |
|---|---|
| PubChem CID | 172957898 |
| Molecular Formula | C46H46N4O14S2 |
| Molecular Weight | 943.02 g/mol |
| Exact Mass | 942.25 |
| IUPAC Name | 1-O-(1-methoxypropan-2-yl) 6-O-[(E)-[(2E)-2-[6-(1-methoxypropan-2-yloxy)-6-oxohexanoyl]oxyimino-1,2-bis(8-nitrodibenzothiophen-2-yl)ethylidene]amino] hexanedioate |
| SMILES | COCC(C)OC(=O)CCCCC(=O)O/N=C(C(=N/OC(=O)CCCCC(=O)OC(C)COC)/c1ccc2sc3ccc([N+](=O)[O-])cc3c2c1)\c1ccc2sc3ccc([N+](=O)[O-])cc3c2c1 |
| InChI | InChI=1S/C46H46N4O14S2/c1-27(25-59-3)61-41(51)9-5-7-11-43(53)63-47-45(29-13-17-37-33(21-29)35-23-31(49(55)56)15-19-39(35)65-37)46(48-64-44(54)12-8-6-10-42(52)62-28(2)26-60-4)30-14-18-38-34(22-30)36-24-32(50(57)58)16-20-40(36)66-38/h13-24,27-28H,5-12,25-26H2,1-4H3/b47-45+,48-46+ |
| InChIKey | FHYORBPBWHEOQB-MLGMXDONSA-N |
| XLogP | 9.71 |
| TPSA | 234.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.02 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|