C37H38F3N3O5 — CID 130327054
[(E)-[[11-(2-ethylhexyl)-8-nitrobenzo[a]carbazol-5-yl]-[4-(2,2,3-trifluorobutoxy)phenyl]methylidene]amino] acetate (PubChem CID 130327054) has the molecular formula C37H38F3N3O5 and a molecular weight of 661.72 g/mol. Its IUPAC name is [(E)-[[11-(2-ethylhexyl)-8-nitrobenzo[a]carbazol-5-yl]-[4-(2,2,3-trifluorobutoxy)phenyl]methylidene]amino] acetate.
| Compound Name | [(E)-[[11-(2-ethylhexyl)-8-nitrobenzo[a]carbazol-5-yl]-[4-(2,2,3-trifluorobutoxy)phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 130327054 |
| Molecular Formula | C37H38F3N3O5 |
| Molecular Weight | 661.72 g/mol |
| Exact Mass | 661.28 |
| IUPAC Name | [(E)-[[11-(2-ethylhexyl)-8-nitrobenzo[a]carbazol-5-yl]-[4-(2,2,3-trifluorobutoxy)phenyl]methylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc([N+](=O)[O-])cc2c2cc(/C(=N/OC(C)=O)c3ccc(OCC(F)(F)C(C)F)cc3)c3ccccc3c21 |
| InChI | InChI=1S/C37H38F3N3O5/c1-5-7-10-25(6-2)21-42-34-18-15-27(43(45)46)19-31(34)33-20-32(29-11-8-9-12-30(29)36(33)42)35(41-48-24(4)44)26-13-16-28(17-14-26)47-22-37(39,40)23(3)38/h8-9,11-20,23,25H,5-7,10,21-22H2,1-4H3/b41-35+ |
| InChIKey | BPPZIYOSLUZDKL-IFEQKJQJSA-N |
| XLogP | 9.76 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.72 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|