C39H40F4N2O3 — CID 130327058
[(Z)-1-[11-(2-ethylhexyl)-5-[4-(3,3,4,4-tetrafluorobutyl)benzoyl]benzo[a]carbazol-8-yl]ethylideneamino] acetate (PubChem CID 130327058) has the molecular formula C39H40F4N2O3 and a molecular weight of 660.75 g/mol. Its IUPAC name is [(Z)-1-[11-(2-ethylhexyl)-5-[4-(3,3,4,4-tetrafluorobutyl)benzoyl]benzo[a]carbazol-8-yl]ethylideneamino] acetate.
| Compound Name | [(Z)-1-[11-(2-ethylhexyl)-5-[4-(3,3,4,4-tetrafluorobutyl)benzoyl]benzo[a]carbazol-8-yl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 130327058 |
| Molecular Formula | C39H40F4N2O3 |
| Molecular Weight | 660.75 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | [(Z)-1-[11-(2-ethylhexyl)-5-[4-(3,3,4,4-tetrafluorobutyl)benzoyl]benzo[a]carbazol-8-yl]ethylideneamino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(/C(C)=N\OC(C)=O)cc2c2cc(C(=O)c3ccc(CCC(F)(F)C(F)F)cc3)c3ccccc3c21 |
| InChI | InChI=1S/C39H40F4N2O3/c1-5-7-10-26(6-2)23-45-35-18-17-29(24(3)44-48-25(4)46)21-32(35)33-22-34(30-11-8-9-12-31(30)36(33)45)37(47)28-15-13-27(14-16-28)19-20-39(42,43)38(40)41/h8-9,11-18,21-22,26,38H,5-7,10,19-20,23H2,1-4H3/b44-24- |
| InChIKey | SCPBAVARFXYHPB-NOCIIAOISA-N |
| XLogP | 10.52 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.75 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|