C48H45N3O5 — CID 88586932
[(E)-[[5-[(2E)-2-acetyloxyimino-2-naphthalen-1-ylacetyl]-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]-(2-methylphenyl)methylidene]amino] acetate (PubChem CID 88586932) has the molecular formula C48H45N3O5 and a molecular weight of 743.90 g/mol. Its IUPAC name is [(E)-[[5-[(2E)-2-acetyloxyimino-2-naphthalen-1-ylacetyl]-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]-(2-methylphenyl)methylidene]amino] acetate.
| Compound Name | [(E)-[[5-[(2E)-2-acetyloxyimino-2-naphthalen-1-ylacetyl]-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]-(2-methylphenyl)methylidene]amino] acetate |
|---|---|
| PubChem CID | 88586932 |
| Molecular Formula | C48H45N3O5 |
| Molecular Weight | 743.90 g/mol |
| Exact Mass | 743.34 |
| IUPAC Name | [(E)-[[5-[(2E)-2-acetyloxyimino-2-naphthalen-1-ylacetyl]-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]-(2-methylphenyl)methylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(/C(=N\OC(C)=O)c3ccccc3C)cc2c2cc(C(=O)/C(=N/OC(C)=O)c3cccc4ccccc34)c3ccccc3c21 |
| InChI | InChI=1S/C48H45N3O5/c1-6-8-17-33(7-2)29-51-44-26-25-35(45(49-55-31(4)52)36-20-11-9-16-30(36)3)27-41(44)42-28-43(38-22-13-14-23-40(38)47(42)51)48(54)46(50-56-32(5)53)39-24-15-19-34-18-10-12-21-37(34)39/h9-16,18-28,33H,6-8,17,29H2,1-5H3/b49-45+,50-46+ |
| InChIKey | HHIBLWJQJZGEPP-XMWVESSBSA-N |
| XLogP | 11.09 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.90 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|