C44H48N2O4 — CID 87281144
[11-(2-ethylhexyl)-8-[(E)-N-hydroxy-C-[2-(2-methoxyethoxy)phenyl]carbonimidoyl]benzo[a]carbazol-5-yl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 87281144) has the molecular formula C44H48N2O4 and a molecular weight of 668.88 g/mol. Its IUPAC name is [11-(2-ethylhexyl)-8-[(E)-N-hydroxy-C-[2-(2-methoxyethoxy)phenyl]carbonimidoyl]benzo[a]carbazol-5-yl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [11-(2-ethylhexyl)-8-[(E)-N-hydroxy-C-[2-(2-methoxyethoxy)phenyl]carbonimidoyl]benzo[a]carbazol-5-yl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 87281144 |
| Molecular Formula | C44H48N2O4 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | [11-(2-ethylhexyl)-8-[(E)-N-hydroxy-C-[2-(2-methoxyethoxy)phenyl]carbonimidoyl]benzo[a]carbazol-5-yl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCCCC(CC)Cn1c2ccc(/C(=N\O)c3ccccc3OCCOC)cc2c2cc(C(=O)c3c(C)cc(C)cc3C)c3ccccc3c21 |
| InChI | InChI=1S/C44H48N2O4/c1-7-9-14-31(8-2)27-46-39-20-19-32(42(45-48)35-17-12-13-18-40(35)50-22-21-49-6)25-36(39)37-26-38(33-15-10-11-16-34(33)43(37)46)44(47)41-29(4)23-28(3)24-30(41)5/h10-13,15-20,23-26,31,48H,7-9,14,21-22,27H2,1-6H3/b45-42+ |
| InChIKey | AIKDVFPXZBKEDC-NYHNVNJYSA-N |
| XLogP | 10.57 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|