C37H42N2O2 — CID 174682975
[11-(2-ethylhexyl)-8-(C-ethyl-N-hydroxycarbonimidoyl)benzo[a]carbazol-5-yl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 174682975) has the molecular formula C37H42N2O2 and a molecular weight of 546.76 g/mol. Its IUPAC name is [11-(2-ethylhexyl)-8-(C-ethyl-N-hydroxycarbonimidoyl)benzo[a]carbazol-5-yl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [11-(2-ethylhexyl)-8-(C-ethyl-N-hydroxycarbonimidoyl)benzo[a]carbazol-5-yl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 174682975 |
| Molecular Formula | C37H42N2O2 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | [11-(2-ethylhexyl)-8-(C-ethyl-N-hydroxycarbonimidoyl)benzo[a]carbazol-5-yl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCCCC(CC)Cn1c2ccc(C(CC)=NO)cc2c2cc(C(=O)c3c(C)cc(C)cc3C)c3ccccc3c21 |
| InChI | InChI=1S/C37H42N2O2/c1-7-10-13-26(8-2)22-39-34-17-16-27(33(9-3)38-41)20-30(34)31-21-32(28-14-11-12-15-29(28)36(31)39)37(40)35-24(5)18-23(4)19-25(35)6/h11-12,14-21,26,41H,7-10,13,22H2,1-6H3 |
| InChIKey | SPYWNLHVRKUOJC-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|