C44H47NO4 — CID 142715472
[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2-methoxyethoxy)phenyl]methanone (PubChem CID 142715472) has the molecular formula C44H47NO4 and a molecular weight of 653.86 g/mol. Its IUPAC name is [11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2-methoxyethoxy)phenyl]methanone.
| Compound Name | [11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2-methoxyethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 142715472 |
| Molecular Formula | C44H47NO4 |
| Molecular Weight | 653.86 g/mol |
| Exact Mass | 653.35 |
| IUPAC Name | [11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2-methoxyethoxy)phenyl]methanone |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=O)c3ccccc3OCCOC)cc2c2cc(C(=O)c3c(C)cc(C)cc3C)c3ccccc3c21 |
| InChI | InChI=1S/C44H47NO4/c1-7-9-14-31(8-2)27-45-39-20-19-32(43(46)35-17-12-13-18-40(35)49-22-21-48-6)25-36(39)37-26-38(33-15-10-11-16-34(33)42(37)45)44(47)41-29(4)23-28(3)24-30(41)5/h10-13,15-20,23-26,31H,7-9,14,21-22,27H2,1-6H3 |
| InChIKey | CBFGMZKHLSWBLL-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.86 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|