C47H50N2O3 — CID 88586993
[(Z)-[[4-[(E)-but-2-en-2-yl]phenyl]-[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]methylidene]amino] acetate (PubChem CID 88586993) has the molecular formula C47H50N2O3 and a molecular weight of 690.93 g/mol. Its IUPAC name is [(Z)-[[4-[(E)-but-2-en-2-yl]phenyl]-[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]methylidene]amino] acetate.
| Compound Name | [(Z)-[[4-[(E)-but-2-en-2-yl]phenyl]-[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 88586993 |
| Molecular Formula | C47H50N2O3 |
| Molecular Weight | 690.93 g/mol |
| Exact Mass | 690.38 |
| IUPAC Name | [(Z)-[[4-[(E)-but-2-en-2-yl]phenyl]-[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]methylidene]amino] acetate |
| SMILES | C/C=C(\C)c1ccc(/C(=N/OC(C)=O)c2ccc3c(c2)c2cc(C(=O)c4c(C)cc(C)cc4C)c4ccccc4c2n3CC(CC)CCCC)cc1 |
| InChI | InChI=1S/C47H50N2O3/c1-9-12-15-34(11-3)28-49-43-23-22-37(45(48-52-33(8)50)36-20-18-35(19-21-36)30(5)10-2)26-40(43)41-27-42(38-16-13-14-17-39(38)46(41)49)47(51)44-31(6)24-29(4)25-32(44)7/h10,13-14,16-27,34H,9,11-12,15,28H2,1-8H3/b30-10+,48-45- |
| InChIKey | MXERYBALOJCCNK-UZQDQHLCSA-N |
| XLogP | 12.06 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.93 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|