C45H48N2O4 — CID 87281153
[(E)-[[11-(2-ethylhexyl)-3-methoxy-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-(2-methylphenyl)methylidene]amino] acetate (PubChem CID 87281153) has the molecular formula C45H48N2O4 and a molecular weight of 680.89 g/mol. Its IUPAC name is [(E)-[[11-(2-ethylhexyl)-3-methoxy-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-(2-methylphenyl)methylidene]amino] acetate.
| Compound Name | [(E)-[[11-(2-ethylhexyl)-3-methoxy-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-(2-methylphenyl)methylidene]amino] acetate |
|---|---|
| PubChem CID | 87281153 |
| Molecular Formula | C45H48N2O4 |
| Molecular Weight | 680.89 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | [(E)-[[11-(2-ethylhexyl)-3-methoxy-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-(2-methylphenyl)methylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(/C(=N\OC(C)=O)c3ccccc3C)cc2c2cc(C(=O)c3c(C)cc(C)cc3C)c3cc(OC)ccc3c21 |
| InChI | InChI=1S/C45H48N2O4/c1-9-11-15-32(10-2)26-47-41-20-17-33(43(46-51-31(7)48)35-16-13-12-14-28(35)4)23-38(41)39-25-40(37-24-34(50-8)18-19-36(37)44(39)47)45(49)42-29(5)21-27(3)22-30(42)6/h12-14,16-25,32H,9-11,15,26H2,1-8H3/b46-43+ |
| InChIKey | HVWBKXHFHWACST-JSQTYGKOSA-N |
| XLogP | 10.95 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.89 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|