C46H48F4N2O4 — CID 172923973
[(Z)-[(2Z,4Z)-1-[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-3-(2,2,3,3-tetrafluoropropoxy)hepta-2,4,6-trienylidene]amino] acetate (PubChem CID 172923973) has the molecular formula C46H48F4N2O4 and a molecular weight of 768.89 g/mol. Its IUPAC name is [(Z)-[(2Z,4Z)-1-[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-3-(2,2,3,3-tetrafluoropropoxy)hepta-2,4,6-trienylidene]amino] acetate.
| Compound Name | [(Z)-[(2Z,4Z)-1-[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-3-(2,2,3,3-tetrafluoropropoxy)hepta-2,4,6-trienylidene]amino] acetate |
|---|---|
| PubChem CID | 172923973 |
| Molecular Formula | C46H48F4N2O4 |
| Molecular Weight | 768.89 g/mol |
| Exact Mass | 768.36 |
| IUPAC Name | [(Z)-[(2Z,4Z)-1-[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-3-(2,2,3,3-tetrafluoropropoxy)hepta-2,4,6-trienylidene]amino] acetate |
| SMILES | C=C/C=C\C(=C\C(=N\OC(C)=O)c1ccc2c(c1)c1cc(C(=O)c3c(C)cc(C)cc3C)c3ccccc3c1n2CC(CC)CCCC)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C46H48F4N2O4/c1-8-11-15-32(10-3)26-52-41-20-19-33(40(51-56-31(7)53)24-34(16-12-9-2)55-27-46(49,50)45(47)48)23-37(41)38-25-39(35-17-13-14-18-36(35)43(38)52)44(54)42-29(5)21-28(4)22-30(42)6/h9,12-14,16-25,32,45H,2,8,10-11,15,26-27H2,1,3-7H3/b16-12-,34-24-,51-40- |
| InChIKey | PABMZRVSVQSPKX-IOQYFXRVSA-N |
| XLogP | 12.13 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.89 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|