C34H39N3O7 — CID 123399455
propyl 4-acetyloxyimino-5-[11-(2-ethylhexyl)-5-nitrobenzo[a]carbazol-8-yl]-5-oxopentanoate (PubChem CID 123399455) has the molecular formula C34H39N3O7 and a molecular weight of 601.70 g/mol. Its IUPAC name is propyl 4-acetyloxyimino-5-[11-(2-ethylhexyl)-5-nitrobenzo[a]carbazol-8-yl]-5-oxopentanoate.
| Compound Name | propyl 4-acetyloxyimino-5-[11-(2-ethylhexyl)-5-nitrobenzo[a]carbazol-8-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 123399455 |
| Molecular Formula | C34H39N3O7 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | propyl 4-acetyloxyimino-5-[11-(2-ethylhexyl)-5-nitrobenzo[a]carbazol-8-yl]-5-oxopentanoate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=O)C(CCC(=O)OCCC)=NOC(C)=O)cc2c2cc([N+](=O)[O-])c3ccccc3c21 |
| InChI | InChI=1S/C34H39N3O7/c1-5-8-11-23(7-3)21-36-30-16-14-24(34(40)29(35-44-22(4)38)15-17-32(39)43-18-6-2)19-27(30)28-20-31(37(41)42)25-12-9-10-13-26(25)33(28)36/h9-10,12-14,16,19-20,23H,5-8,11,15,17-18,21H2,1-4H3 |
| InChIKey | ZZNFBPNUFGZCRL-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 130.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|