C41H53N3O6 — CID 156846319
[(E)-[1-[6-[4-(diethylamino)benzoyl]-9-(2-ethylhexyl)carbazol-3-yl]-1-oxoheptan-2-ylidene]amino] acetate;formic acid (PubChem CID 156846319) has the molecular formula C41H53N3O6 and a molecular weight of 683.89 g/mol. Its IUPAC name is [(E)-[1-[6-[4-(diethylamino)benzoyl]-9-(2-ethylhexyl)carbazol-3-yl]-1-oxoheptan-2-ylidene]amino] acetate;formic acid.
| Compound Name | [(E)-[1-[6-[4-(diethylamino)benzoyl]-9-(2-ethylhexyl)carbazol-3-yl]-1-oxoheptan-2-ylidene]amino] acetate;formic acid |
|---|---|
| PubChem CID | 156846319 |
| Molecular Formula | C41H53N3O6 |
| Molecular Weight | 683.89 g/mol |
| Exact Mass | 683.39 |
| IUPAC Name | [(E)-[1-[6-[4-(diethylamino)benzoyl]-9-(2-ethylhexyl)carbazol-3-yl]-1-oxoheptan-2-ylidene]amino] acetate;formic acid |
| SMILES | CCCCC/C(=N\OC(C)=O)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccc(N(CC)CC)cc3)ccc1n2CC(CC)CCCC.O=CO |
| InChI | InChI=1S/C40H51N3O4.CH2O2/c1-7-12-14-16-36(41-47-28(6)44)40(46)32-20-24-38-35(26-32)34-25-31(19-23-37(34)43(38)27-29(9-3)15-13-8-2)39(45)30-17-21-33(22-18-30)42(10-4)11-5;2-1-3/h17-26,29H,7-16,27H2,1-6H3;1H,(H,2,3)/b41-36+; |
| InChIKey | LZTPNDOSZURCBL-VQKDWEPRSA-N |
| XLogP | 9.47 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.89 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|