C34H40FN3O3 — CID 155359084
[(Z)-[1-[6-benzoyl-9-(2-ethylhexyl)carbazol-3-yl]-2-fluoroethylidene]amino] N,N-diethylcarbamate (PubChem CID 155359084) has the molecular formula C34H40FN3O3 and a molecular weight of 557.71 g/mol. Its IUPAC name is [(Z)-[1-[6-benzoyl-9-(2-ethylhexyl)carbazol-3-yl]-2-fluoroethylidene]amino] N,N-diethylcarbamate.
| Compound Name | [(Z)-[1-[6-benzoyl-9-(2-ethylhexyl)carbazol-3-yl]-2-fluoroethylidene]amino] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 155359084 |
| Molecular Formula | C34H40FN3O3 |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | [(Z)-[1-[6-benzoyl-9-(2-ethylhexyl)carbazol-3-yl]-2-fluoroethylidene]amino] N,N-diethylcarbamate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=O)c3ccccc3)cc2c2cc(/C(CF)=N/OC(=O)N(CC)CC)ccc21 |
| InChI | InChI=1S/C34H40FN3O3/c1-5-9-13-24(6-2)23-38-31-18-16-26(30(22-35)36-41-34(40)37(7-3)8-4)20-28(31)29-21-27(17-19-32(29)38)33(39)25-14-11-10-12-15-25/h10-12,14-21,24H,5-9,13,22-23H2,1-4H3/b36-30+ |
| InChIKey | QRIUNOFSDWGMKC-FMIFUCRQSA-N |
| XLogP | 8.39 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|