C37H46N2O3 — CID 166731425
(2E)-1-[9-(2-ethylhexyl)-6-(4-methylbenzoyl)carbazol-3-yl]-2-methoxyiminooctan-1-one (PubChem CID 166731425) has the molecular formula C37H46N2O3 and a molecular weight of 566.79 g/mol. Its IUPAC name is (2E)-1-[9-(2-ethylhexyl)-6-(4-methylbenzoyl)carbazol-3-yl]-2-methoxyiminooctan-1-one.
| Compound Name | (2E)-1-[9-(2-ethylhexyl)-6-(4-methylbenzoyl)carbazol-3-yl]-2-methoxyiminooctan-1-one |
|---|---|
| PubChem CID | 166731425 |
| Molecular Formula | C37H46N2O3 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | (2E)-1-[9-(2-ethylhexyl)-6-(4-methylbenzoyl)carbazol-3-yl]-2-methoxyiminooctan-1-one |
| SMILES | CCCCCC/C(=N\OC)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccc(C)cc3)ccc1n2CC(CC)CCCC |
| InChI | InChI=1S/C37H46N2O3/c1-6-9-11-12-14-33(38-42-5)37(41)30-20-22-35-32(24-30)31-23-29(36(40)28-17-15-26(4)16-18-28)19-21-34(31)39(35)25-27(8-3)13-10-7-2/h15-24,27H,6-14,25H2,1-5H3/b38-33+ |
| InChIKey | RWFXHYPJSZWSFY-NNIBMBRCSA-N |
| XLogP | 9.71 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|