C44H48N2O6 — CID 156846277
[4-[6-[(2E)-2-acetyloxyiminoheptanoyl]-9-(2-ethylhexyl)carbazole-3-carbonyl]phenyl] 2-phenylacetate (PubChem CID 156846277) has the molecular formula C44H48N2O6 and a molecular weight of 700.88 g/mol. Its IUPAC name is [4-[6-[(2E)-2-acetyloxyiminoheptanoyl]-9-(2-ethylhexyl)carbazole-3-carbonyl]phenyl] 2-phenylacetate.
| Compound Name | [4-[6-[(2E)-2-acetyloxyiminoheptanoyl]-9-(2-ethylhexyl)carbazole-3-carbonyl]phenyl] 2-phenylacetate |
|---|---|
| PubChem CID | 156846277 |
| Molecular Formula | C44H48N2O6 |
| Molecular Weight | 700.88 g/mol |
| Exact Mass | 700.35 |
| IUPAC Name | [4-[6-[(2E)-2-acetyloxyiminoheptanoyl]-9-(2-ethylhexyl)carbazole-3-carbonyl]phenyl] 2-phenylacetate |
| SMILES | CCCCC/C(=N\OC(C)=O)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccc(OC(=O)Cc4ccccc4)cc3)ccc1n2CC(CC)CCCC |
| InChI | InChI=1S/C44H48N2O6/c1-5-8-11-17-39(45-52-30(4)47)44(50)35-21-25-41-38(28-35)37-27-34(20-24-40(37)46(41)29-31(7-3)14-9-6-2)43(49)33-18-22-36(23-19-33)51-42(48)26-32-15-12-10-13-16-32/h10,12-13,15-16,18-25,27-28,31H,5-9,11,14,17,26,29H2,1-4H3/b45-39+ |
| InChIKey | GCKZMDSUVGVLQF-UGEXAEMASA-N |
| XLogP | 10.07 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.88 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|