C30H28N2O5 — CID 166731432
[4-[9-ethyl-6-[(2E)-2-methoxyiminohex-5-enoyl]carbazole-3-carbonyl]phenyl] acetate (PubChem CID 166731432) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is [4-[9-ethyl-6-[(2E)-2-methoxyiminohex-5-enoyl]carbazole-3-carbonyl]phenyl] acetate.
| Compound Name | [4-[9-ethyl-6-[(2E)-2-methoxyiminohex-5-enoyl]carbazole-3-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 166731432 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [4-[9-ethyl-6-[(2E)-2-methoxyiminohex-5-enoyl]carbazole-3-carbonyl]phenyl] acetate |
| SMILES | C=CCC/C(=N\OC)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccc(OC(C)=O)cc3)ccc1n2CC |
| InChI | InChI=1S/C30H28N2O5/c1-5-7-8-26(31-36-4)30(35)22-12-16-28-25(18-22)24-17-21(11-15-27(24)32(28)6-2)29(34)20-9-13-23(14-10-20)37-19(3)33/h5,9-18H,1,6-8H2,2-4H3/b31-26+ |
| InChIKey | BZBGORZVIURIDY-GKPLWNPISA-N |
| XLogP | 6.12 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|