C39H31BrN2O4S — CID 76562867
[[4-(4-bromophenyl)sulfanyl-1-[9-ethyl-6-(4-phenylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] acetate (PubChem CID 76562867) has the molecular formula C39H31BrN2O4S and a molecular weight of 703.66 g/mol. Its IUPAC name is [[4-(4-bromophenyl)sulfanyl-1-[9-ethyl-6-(4-phenylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] acetate.
| Compound Name | [[4-(4-bromophenyl)sulfanyl-1-[9-ethyl-6-(4-phenylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 76562867 |
| Molecular Formula | C39H31BrN2O4S |
| Molecular Weight | 703.66 g/mol |
| Exact Mass | 702.12 |
| IUPAC Name | [[4-(4-bromophenyl)sulfanyl-1-[9-ethyl-6-(4-phenylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)C(CCSc3ccc(Br)cc3)=NOC(C)=O)cc2c2cc(C(=O)c3ccc(-c4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C39H31BrN2O4S/c1-3-42-36-19-13-29(38(44)28-11-9-27(10-12-28)26-7-5-4-6-8-26)23-33(36)34-24-30(14-20-37(34)42)39(45)35(41-46-25(2)43)21-22-47-32-17-15-31(40)16-18-32/h4-20,23-24H,3,21-22H2,1-2H3 |
| InChIKey | HILNKYUUMRLLJM-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.66 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|