C33H29ClN2O4S — CID 172933674
(2E)-1-(6-benzoyl-9-ethylcarbazol-3-yl)-4-(4-chlorophenyl)sulfanyl-2-(1-hydroxyethoxyimino)butan-1-one (PubChem CID 172933674) has the molecular formula C33H29ClN2O4S and a molecular weight of 585.13 g/mol. Its IUPAC name is (2E)-1-(6-benzoyl-9-ethylcarbazol-3-yl)-4-(4-chlorophenyl)sulfanyl-2-(1-hydroxyethoxyimino)butan-1-one.
| Compound Name | (2E)-1-(6-benzoyl-9-ethylcarbazol-3-yl)-4-(4-chlorophenyl)sulfanyl-2-(1-hydroxyethoxyimino)butan-1-one |
|---|---|
| PubChem CID | 172933674 |
| Molecular Formula | C33H29ClN2O4S |
| Molecular Weight | 585.13 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | (2E)-1-(6-benzoyl-9-ethylcarbazol-3-yl)-4-(4-chlorophenyl)sulfanyl-2-(1-hydroxyethoxyimino)butan-1-one |
| SMILES | CCn1c2ccc(C(=O)/C(CCSc3ccc(Cl)cc3)=N/OC(C)O)cc2c2cc(C(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C33H29ClN2O4S/c1-3-36-30-15-9-23(32(38)22-7-5-4-6-8-22)19-27(30)28-20-24(10-16-31(28)36)33(39)29(35-40-21(2)37)17-18-41-26-13-11-25(34)12-14-26/h4-16,19-21,37H,3,17-18H2,1-2H3/b35-29+ |
| InChIKey | JPFHTWGSLBUGFL-OZMGXUMRSA-N |
| XLogP | 7.77 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.13 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|