C37H34ClIN2O4S — CID 89202032
[(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-iodobenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] hexanoate (PubChem CID 89202032) has the molecular formula C37H34ClIN2O4S and a molecular weight of 765.11 g/mol. Its IUPAC name is [(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-iodobenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] hexanoate.
| Compound Name | [(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-iodobenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] hexanoate |
|---|---|
| PubChem CID | 89202032 |
| Molecular Formula | C37H34ClIN2O4S |
| Molecular Weight | 765.11 g/mol |
| Exact Mass | 764.10 |
| IUPAC Name | [(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-iodobenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] hexanoate |
| SMILES | CCCCCC(=O)O/N=C(\CCSc1ccc(Cl)cc1)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3I)ccc1n2CC |
| InChI | InChI=1S/C37H34ClIN2O4S/c1-3-5-6-11-35(42)45-40-32(20-21-46-27-16-14-26(38)15-17-27)37(44)25-13-19-34-30(23-25)29-22-24(12-18-33(29)41(34)4-2)36(43)28-9-7-8-10-31(28)39/h7-10,12-19,22-23H,3-6,11,20-21H2,1-2H3/b40-32+ |
| InChIKey | QVKFZYPUIOBZEP-GGPBTZDJSA-N |
| XLogP | 10.15 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.11 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|