C34H29IN2O4S — CID 88578249
[(E)-[1-[9-ethyl-6-(2-iodobenzoyl)carbazol-3-yl]-1-oxo-4-phenylsulfanylpentan-2-ylidene]amino] acetate (PubChem CID 88578249) has the molecular formula C34H29IN2O4S and a molecular weight of 688.59 g/mol. Its IUPAC name is [(E)-[1-[9-ethyl-6-(2-iodobenzoyl)carbazol-3-yl]-1-oxo-4-phenylsulfanylpentan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[9-ethyl-6-(2-iodobenzoyl)carbazol-3-yl]-1-oxo-4-phenylsulfanylpentan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 88578249 |
| Molecular Formula | C34H29IN2O4S |
| Molecular Weight | 688.59 g/mol |
| Exact Mass | 688.09 |
| IUPAC Name | [(E)-[1-[9-ethyl-6-(2-iodobenzoyl)carbazol-3-yl]-1-oxo-4-phenylsulfanylpentan-2-ylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)/C(CC(C)Sc3ccccc3)=N/OC(C)=O)cc2c2cc(C(=O)c3ccccc3I)ccc21 |
| InChI | InChI=1S/C34H29IN2O4S/c1-4-37-31-16-14-23(33(39)26-12-8-9-13-29(26)35)19-27(31)28-20-24(15-17-32(28)37)34(40)30(36-41-22(3)38)18-21(2)42-25-10-6-5-7-11-25/h5-17,19-21H,4,18H2,1-3H3/b36-30+ |
| InChIKey | BZPMEDWMCGFSAN-FMIFUCRQSA-N |
| XLogP | 8.32 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.59 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|