C44H48N2O4 — CID 154659398
[(E)-[1-[6-(9,9-dibutylfluorene-3-carbonyl)-9-ethylcarbazol-3-yl]-4-methyl-1-oxopentan-2-ylidene]amino] acetate (PubChem CID 154659398) has the molecular formula C44H48N2O4 and a molecular weight of 668.88 g/mol. Its IUPAC name is [(E)-[1-[6-(9,9-dibutylfluorene-3-carbonyl)-9-ethylcarbazol-3-yl]-4-methyl-1-oxopentan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[6-(9,9-dibutylfluorene-3-carbonyl)-9-ethylcarbazol-3-yl]-4-methyl-1-oxopentan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 154659398 |
| Molecular Formula | C44H48N2O4 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | [(E)-[1-[6-(9,9-dibutylfluorene-3-carbonyl)-9-ethylcarbazol-3-yl]-4-methyl-1-oxopentan-2-ylidene]amino] acetate |
| SMILES | CCCCC1(CCCC)c2ccccc2-c2cc(C(=O)c3ccc4c(c3)c3cc(C(=O)/C(CC(C)C)=N/OC(C)=O)ccc3n4CC)ccc21 |
| InChI | InChI=1S/C44H48N2O4/c1-7-10-22-44(23-11-8-2)37-15-13-12-14-33(37)34-25-30(16-19-38(34)44)42(48)31-17-20-40-35(26-31)36-27-32(18-21-41(36)46(40)9-3)43(49)39(24-28(4)5)45-50-29(6)47/h12-21,25-28H,7-11,22-24H2,1-6H3/b45-39+ |
| InChIKey | YXWRFDFJBVOUGD-UGEXAEMASA-N |
| XLogP | 10.84 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|