C31H28N2O5 — CID 76562826
[[1-[9-ethyl-6-[(3-oxo-1-benzofuran-2-ylidene)methyl]carbazol-3-yl]-1-oxohexan-2-ylidene]amino] acetate (PubChem CID 76562826) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is [[1-[9-ethyl-6-[(3-oxo-1-benzofuran-2-ylidene)methyl]carbazol-3-yl]-1-oxohexan-2-ylidene]amino] acetate.
| Compound Name | [[1-[9-ethyl-6-[(3-oxo-1-benzofuran-2-ylidene)methyl]carbazol-3-yl]-1-oxohexan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 76562826 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | [[1-[9-ethyl-6-[(3-oxo-1-benzofuran-2-ylidene)methyl]carbazol-3-yl]-1-oxohexan-2-ylidene]amino] acetate |
| SMILES | CCCCC(=NOC(C)=O)C(=O)c1ccc2c(c1)c1cc(C=C3Oc4ccccc4C3=O)ccc1n2CC |
| InChI | InChI=1S/C31H28N2O5/c1-4-6-10-25(32-38-19(3)34)30(35)21-13-15-27-24(18-21)23-16-20(12-14-26(23)33(27)5-2)17-29-31(36)22-9-7-8-11-28(22)37-29/h7-9,11-18H,4-6,10H2,1-3H3 |
| InChIKey | IQDNRWKRRARHEH-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|