C33H36N2O5 — CID 123512640
[[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methoxy-2-methylpropanoate (PubChem CID 123512640) has the molecular formula C33H36N2O5 and a molecular weight of 540.66 g/mol. Its IUPAC name is [[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methoxy-2-methylpropanoate.
| Compound Name | [[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methoxy-2-methylpropanoate |
|---|---|
| PubChem CID | 123512640 |
| Molecular Formula | C33H36N2O5 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | [[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methoxy-2-methylpropanoate |
| SMILES | CCCCC(=NOC(=O)C(C)(C)OC)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3C)ccc1n2CC |
| InChI | InChI=1S/C33H36N2O5/c1-7-9-14-27(34-40-32(38)33(4,5)39-6)31(37)23-16-18-29-26(20-23)25-19-22(15-17-28(25)35(29)8-2)30(36)24-13-11-10-12-21(24)3/h10-13,15-20H,7-9,14H2,1-6H3 |
| InChIKey | CFXWAKOPFHWPSF-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|