C30H30N2O5 — CID 123904230
[[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] 2-hydroxy-2-methylpropanoate (PubChem CID 123904230) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is [[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] 2-hydroxy-2-methylpropanoate.
| Compound Name | [[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] 2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 123904230 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] 2-hydroxy-2-methylpropanoate |
| SMILES | CCC(=NOC(=O)C(C)(C)O)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3C)ccc1n2CC |
| InChI | InChI=1S/C30H30N2O5/c1-6-24(31-37-29(35)30(4,5)36)28(34)20-13-15-26-23(17-20)22-16-19(12-14-25(22)32(26)7-2)27(33)21-11-9-8-10-18(21)3/h8-17,36H,6-7H2,1-5H3 |
| InChIKey | HZJHOKDSNHKOBI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|