C32H35N3O4 — CID 123404733
[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino] 2-methyl-2-morpholin-4-ylpropanoate (PubChem CID 123404733) has the molecular formula C32H35N3O4 and a molecular weight of 525.65 g/mol. Its IUPAC name is [1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino] 2-methyl-2-morpholin-4-ylpropanoate.
| Compound Name | [1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino] 2-methyl-2-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 123404733 |
| Molecular Formula | C32H35N3O4 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | [1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino] 2-methyl-2-morpholin-4-ylpropanoate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2cc(C(C)=NOC(=O)C(C)(C)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C32H35N3O4/c1-6-35-28-13-11-23(22(3)33-39-31(37)32(4,5)34-15-17-38-18-16-34)19-26(28)27-20-24(12-14-29(27)35)30(36)25-10-8-7-9-21(25)2/h7-14,19-20H,6,15-18H2,1-5H3 |
| InChIKey | HWXXDOLQYQJHCP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|