C36H41N3O5 — CID 123642792
[[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methyl-2-morpholin-4-ylpropanoate (PubChem CID 123642792) has the molecular formula C36H41N3O5 and a molecular weight of 595.74 g/mol. Its IUPAC name is [[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methyl-2-morpholin-4-ylpropanoate.
| Compound Name | [[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methyl-2-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 123642792 |
| Molecular Formula | C36H41N3O5 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | [[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methyl-2-morpholin-4-ylpropanoate |
| SMILES | CCCCC(=NOC(=O)C(C)(C)N1CCOCC1)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3C)ccc1n2CC |
| InChI | InChI=1S/C36H41N3O5/c1-6-8-13-30(37-44-35(42)36(4,5)38-18-20-43-21-19-38)34(41)26-15-17-32-29(23-26)28-22-25(14-16-31(28)39(32)7-2)33(40)27-12-10-9-11-24(27)3/h9-12,14-17,22-23H,6-8,13,18-21H2,1-5H3 |
| InChIKey | RSRJTVNVFWFGHF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|