C32H29ClN2O3S — CID 172982708
(2E)-4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-[hydroxy(phenyl)methyl]carbazol-3-yl]-2-methoxyiminobutan-1-one (PubChem CID 172982708) has the molecular formula C32H29ClN2O3S and a molecular weight of 557.12 g/mol. Its IUPAC name is (2E)-4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-[hydroxy(phenyl)methyl]carbazol-3-yl]-2-methoxyiminobutan-1-one.
| Compound Name | (2E)-4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-[hydroxy(phenyl)methyl]carbazol-3-yl]-2-methoxyiminobutan-1-one |
|---|---|
| PubChem CID | 172982708 |
| Molecular Formula | C32H29ClN2O3S |
| Molecular Weight | 557.12 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | (2E)-4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-[hydroxy(phenyl)methyl]carbazol-3-yl]-2-methoxyiminobutan-1-one |
| SMILES | CCn1c2ccc(C(=O)/C(CCSc3ccc(Cl)cc3)=N/OC)cc2c2cc(C(O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C32H29ClN2O3S/c1-3-35-29-15-9-22(31(36)21-7-5-4-6-8-21)19-26(29)27-20-23(10-16-30(27)35)32(37)28(34-38-2)17-18-39-25-13-11-24(33)12-14-25/h4-16,19-20,31,36H,3,17-18H2,1-2H3/b34-28+ |
| InChIKey | ILAHTDISVUBVKN-CDSHQWRTSA-N |
| XLogP | 7.92 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.12 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|