C39H33ClN2O4S2 — CID 172987288
[(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(4-phenylsulfanylbenzoyl)carbazol-3-yl]-1-hydroxybutan-2-ylidene]amino] acetate (PubChem CID 172987288) has the molecular formula C39H33ClN2O4S2 and a molecular weight of 693.29 g/mol. Its IUPAC name is [(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(4-phenylsulfanylbenzoyl)carbazol-3-yl]-1-hydroxybutan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(4-phenylsulfanylbenzoyl)carbazol-3-yl]-1-hydroxybutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 172987288 |
| Molecular Formula | C39H33ClN2O4S2 |
| Molecular Weight | 693.29 g/mol |
| Exact Mass | 692.16 |
| IUPAC Name | [(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(4-phenylsulfanylbenzoyl)carbazol-3-yl]-1-hydroxybutan-2-ylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3ccc(Sc4ccccc4)cc3)cc2c2cc(C(O)/C(CCSc3ccc(Cl)cc3)=N/OC(C)=O)ccc21 |
| InChI | InChI=1S/C39H33ClN2O4S2/c1-3-42-36-19-11-27(38(44)26-9-15-32(16-10-26)48-31-7-5-4-6-8-31)23-33(36)34-24-28(12-20-37(34)42)39(45)35(41-46-25(2)43)21-22-47-30-17-13-29(40)14-18-30/h4-20,23-24,39,45H,3,21-22H2,1-2H3/b41-35+ |
| InChIKey | HASZTHQQTPZKDG-IFEQKJQJSA-N |
| XLogP | 9.98 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.29 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|