C31H26ClNO3S2 — CID 129159667
[(Z)-[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanylbutan-2-ylidene]amino] acetate (PubChem CID 129159667) has the molecular formula C31H26ClNO3S2 and a molecular weight of 560.14 g/mol. Its IUPAC name is [(Z)-[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanylbutan-2-ylidene]amino] acetate.
| Compound Name | [(Z)-[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanylbutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 129159667 |
| Molecular Formula | C31H26ClNO3S2 |
| Molecular Weight | 560.14 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | [(Z)-[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanylbutan-2-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\CCSc1ccc(Cl)cc1)Cc1ccc(Sc2ccc(C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H26ClNO3S2/c1-22(34)36-33-27(19-20-37-28-17-11-26(32)12-18-28)21-23-7-13-29(14-8-23)38-30-15-9-25(10-16-30)31(35)24-5-3-2-4-6-24/h2-18H,19-21H2,1H3/b33-27+ |
| InChIKey | FTIHIOTYBAYVIF-MUGXBBEHSA-N |
| XLogP | 8.37 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.14 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|