C35H35ClNO5PS2 — CID 89202049
[(E)-[(Z)-4-[4-(4-benzoylphenyl)sulfanylphenyl]-1-(4-chlorophenyl)sulfanylhex-4-en-3-ylidene]amino] diethyl phosphate (PubChem CID 89202049) has the molecular formula C35H35ClNO5PS2 and a molecular weight of 680.23 g/mol. Its IUPAC name is [(E)-[(Z)-4-[4-(4-benzoylphenyl)sulfanylphenyl]-1-(4-chlorophenyl)sulfanylhex-4-en-3-ylidene]amino] diethyl phosphate.
| Compound Name | [(E)-[(Z)-4-[4-(4-benzoylphenyl)sulfanylphenyl]-1-(4-chlorophenyl)sulfanylhex-4-en-3-ylidene]amino] diethyl phosphate |
|---|---|
| PubChem CID | 89202049 |
| Molecular Formula | C35H35ClNO5PS2 |
| Molecular Weight | 680.23 g/mol |
| Exact Mass | 679.14 |
| IUPAC Name | [(E)-[(Z)-4-[4-(4-benzoylphenyl)sulfanylphenyl]-1-(4-chlorophenyl)sulfanylhex-4-en-3-ylidene]amino] diethyl phosphate |
| SMILES | C/C=C(C(\CCSc1ccc(Cl)cc1)=N\OP(=O)(OCC)OCC)/c1ccc(Sc2ccc(C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C35H35ClNO5PS2/c1-4-33(34(37-42-43(39,40-5-2)41-6-3)24-25-44-30-22-16-29(36)17-23-30)26-12-18-31(19-13-26)45-32-20-14-28(15-21-32)35(38)27-10-8-7-9-11-27/h4,7-23H,5-6,24-25H2,1-3H3/b33-4-,37-34+ |
| InChIKey | OFETVAHGTNKYEF-XLBXGBAKSA-N |
| XLogP | 10.86 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.23 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|