C30H21ClF3NO5S3 — CID 76562902
[[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanyl-1-oxobutan-2-ylidene]amino] trifluoromethanesulfonate (PubChem CID 76562902) has the molecular formula C30H21ClF3NO5S3 and a molecular weight of 664.15 g/mol. Its IUPAC name is [[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanyl-1-oxobutan-2-ylidene]amino] trifluoromethanesulfonate.
| Compound Name | [[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanyl-1-oxobutan-2-ylidene]amino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 76562902 |
| Molecular Formula | C30H21ClF3NO5S3 |
| Molecular Weight | 664.15 g/mol |
| Exact Mass | 663.02 |
| IUPAC Name | [[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanyl-1-oxobutan-2-ylidene]amino] trifluoromethanesulfonate |
| SMILES | O=C(C(CCSc1ccc(Cl)cc1)=NOS(=O)(=O)C(F)(F)F)c1ccc(Sc2ccc(C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H21ClF3NO5S3/c31-23-10-16-24(17-11-23)41-19-18-27(35-40-43(38,39)30(32,33)34)29(37)22-8-14-26(15-9-22)42-25-12-6-21(7-13-25)28(36)20-4-2-1-3-5-20/h1-17H,18-19H2 |
| InChIKey | FZHYMXDFCQLRBP-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.15 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|