C39H32ClNO5S — CID 172988851
[(E)-[6-(4-chlorophenyl)-1-oxo-1-[4-[4-(4-phenoxybenzoyl)phenyl]sulfanylphenyl]hexan-2-ylidene]amino] acetate (PubChem CID 172988851) has the molecular formula C39H32ClNO5S and a molecular weight of 662.21 g/mol. Its IUPAC name is [(E)-[6-(4-chlorophenyl)-1-oxo-1-[4-[4-(4-phenoxybenzoyl)phenyl]sulfanylphenyl]hexan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[6-(4-chlorophenyl)-1-oxo-1-[4-[4-(4-phenoxybenzoyl)phenyl]sulfanylphenyl]hexan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 172988851 |
| Molecular Formula | C39H32ClNO5S |
| Molecular Weight | 662.21 g/mol |
| Exact Mass | 661.17 |
| IUPAC Name | [(E)-[6-(4-chlorophenyl)-1-oxo-1-[4-[4-(4-phenoxybenzoyl)phenyl]sulfanylphenyl]hexan-2-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\CCCCc1ccc(Cl)cc1)C(=O)c1ccc(Sc2ccc(C(=O)c3ccc(Oc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H32ClNO5S/c1-27(42)46-41-37(10-6-5-7-28-11-19-32(40)20-12-28)39(44)31-17-25-36(26-18-31)47-35-23-15-30(16-24-35)38(43)29-13-21-34(22-14-29)45-33-8-3-2-4-9-33/h2-4,8-9,11-26H,5-7,10H2,1H3/b41-37+ |
| InChIKey | LVXTVVJMACAEIK-SWNXMFJWSA-N |
| XLogP | 10.03 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.21 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|