C23H25NO3S — CID 123213751
[[4-cyclopentyl-1-oxo-1-(4-phenylsulfanylphenyl)butan-2-ylidene]amino] acetate (PubChem CID 123213751) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is [[4-cyclopentyl-1-oxo-1-(4-phenylsulfanylphenyl)butan-2-ylidene]amino] acetate.
| Compound Name | [[4-cyclopentyl-1-oxo-1-(4-phenylsulfanylphenyl)butan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 123213751 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [[4-cyclopentyl-1-oxo-1-(4-phenylsulfanylphenyl)butan-2-ylidene]amino] acetate |
| SMILES | CC(=O)ON=C(CCC1CCCC1)C(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO3S/c1-17(25)27-24-22(16-11-18-7-5-6-8-18)23(26)19-12-14-21(15-13-19)28-20-9-3-2-4-10-20/h2-4,9-10,12-15,18H,5-8,11,16H2,1H3 |
| InChIKey | SFAUMLDFJSYGHK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|