C30H34N2O6S — CID 130271916
[(E)-[1-[4-[4-[(2E)-4-cyclopentyl-2-propanoyloxyiminobutanoyl]phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] propanoate (PubChem CID 130271916) has the molecular formula C30H34N2O6S and a molecular weight of 550.68 g/mol. Its IUPAC name is [(E)-[1-[4-[4-[(2E)-4-cyclopentyl-2-propanoyloxyiminobutanoyl]phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] propanoate.
| Compound Name | [(E)-[1-[4-[4-[(2E)-4-cyclopentyl-2-propanoyloxyiminobutanoyl]phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] propanoate |
|---|---|
| PubChem CID | 130271916 |
| Molecular Formula | C30H34N2O6S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | [(E)-[1-[4-[4-[(2E)-4-cyclopentyl-2-propanoyloxyiminobutanoyl]phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] propanoate |
| SMILES | CCC(=O)O/N=C(\C)C(=O)c1ccc(Sc2ccc(C(=O)/C(CCC3CCCC3)=N/OC(=O)CC)cc2)cc1 |
| InChI | InChI=1S/C30H34N2O6S/c1-4-27(33)37-31-20(3)29(35)22-11-15-24(16-12-22)39-25-17-13-23(14-18-25)30(36)26(32-38-28(34)5-2)19-10-21-8-6-7-9-21/h11-18,21H,4-10,19H2,1-3H3/b31-20+,32-26+ |
| InChIKey | QORBDVIZNZDDIR-BTJSLHBISA-N |
| XLogP | 6.81 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|