C29H35NO3S — CID 118902042
[(E)-[4-cyclohexyl-1-oxo-1-(4-phenylsulfanylphenyl)butan-2-ylidene]amino] cyclohexanecarboxylate (PubChem CID 118902042) has the molecular formula C29H35NO3S and a molecular weight of 477.67 g/mol. Its IUPAC name is [(E)-[4-cyclohexyl-1-oxo-1-(4-phenylsulfanylphenyl)butan-2-ylidene]amino] cyclohexanecarboxylate.
| Compound Name | [(E)-[4-cyclohexyl-1-oxo-1-(4-phenylsulfanylphenyl)butan-2-ylidene]amino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 118902042 |
| Molecular Formula | C29H35NO3S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | [(E)-[4-cyclohexyl-1-oxo-1-(4-phenylsulfanylphenyl)butan-2-ylidene]amino] cyclohexanecarboxylate |
| SMILES | O=C(/C(CCC1CCCCC1)=N/OC(=O)C1CCCCC1)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C29H35NO3S/c31-28(23-17-19-26(20-18-23)34-25-14-8-3-9-15-25)27(21-16-22-10-4-1-5-11-22)30-33-29(32)24-12-6-2-7-13-24/h3,8-9,14-15,17-20,22,24H,1-2,4-7,10-13,16,21H2/b30-27+ |
| InChIKey | VQQKYNLTVSTMJR-KDJFERLWSA-N |
| XLogP | 7.86 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|