C21H22O2S — CID 175975963
4-cyclopentyl-1-(4-phenylsulfanylphenyl)butane-1,2-dione (PubChem CID 175975963) has the molecular formula C21H22O2S and a molecular weight of 338.47 g/mol. Its IUPAC name is 4-cyclopentyl-1-(4-phenylsulfanylphenyl)butane-1,2-dione.
| Compound Name | 4-cyclopentyl-1-(4-phenylsulfanylphenyl)butane-1,2-dione |
|---|---|
| PubChem CID | 175975963 |
| Molecular Formula | C21H22O2S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-cyclopentyl-1-(4-phenylsulfanylphenyl)butane-1,2-dione |
| SMILES | O=C(CCC1CCCC1)C(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C21H22O2S/c22-20(15-10-16-6-4-5-7-16)21(23)17-11-13-19(14-12-17)24-18-8-2-1-3-9-18/h1-3,8-9,11-14,16H,4-7,10,15H2 |
| InChIKey | WXEAHUJKSRZAAP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|