C26H31NO3S — CID 118902049
[(E)-[3-cyclopropyl-1-oxo-1-(4-phenylsulfanylphenyl)propan-2-ylidene]amino] octanoate (PubChem CID 118902049) has the molecular formula C26H31NO3S and a molecular weight of 437.61 g/mol. Its IUPAC name is [(E)-[3-cyclopropyl-1-oxo-1-(4-phenylsulfanylphenyl)propan-2-ylidene]amino] octanoate.
| Compound Name | [(E)-[3-cyclopropyl-1-oxo-1-(4-phenylsulfanylphenyl)propan-2-ylidene]amino] octanoate |
|---|---|
| PubChem CID | 118902049 |
| Molecular Formula | C26H31NO3S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [(E)-[3-cyclopropyl-1-oxo-1-(4-phenylsulfanylphenyl)propan-2-ylidene]amino] octanoate |
| SMILES | CCCCCCCC(=O)O/N=C(\CC1CC1)C(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C26H31NO3S/c1-2-3-4-5-9-12-25(28)30-27-24(19-20-13-14-20)26(29)21-15-17-23(18-16-21)31-22-10-7-6-8-11-22/h6-8,10-11,15-18,20H,2-5,9,12-14,19H2,1H3/b27-24+ |
| InChIKey | FZVKWJHCJAFDAE-SOYKGTTHSA-N |
| XLogP | 7.08 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|