C27H29NO2S — CID 172847601
(2Z)-2-phenylmethoxyimino-1-(4-phenylsulfanylphenyl)octan-1-one (PubChem CID 172847601) has the molecular formula C27H29NO2S and a molecular weight of 431.60 g/mol. Its IUPAC name is (2Z)-2-phenylmethoxyimino-1-(4-phenylsulfanylphenyl)octan-1-one.
| Compound Name | (2Z)-2-phenylmethoxyimino-1-(4-phenylsulfanylphenyl)octan-1-one |
|---|---|
| PubChem CID | 172847601 |
| Molecular Formula | C27H29NO2S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (2Z)-2-phenylmethoxyimino-1-(4-phenylsulfanylphenyl)octan-1-one |
| SMILES | CCCCCC/C(=N/OCc1ccccc1)C(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29NO2S/c1-2-3-4-11-16-26(28-30-21-22-12-7-5-8-13-22)27(29)23-17-19-25(20-18-23)31-24-14-9-6-10-15-24/h5-10,12-15,17-20H,2-4,11,16,21H2,1H3/b28-26- |
| InChIKey | XQEOHFQIDHWQFK-SGEDCAFJSA-N |
| XLogP | 7.56 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|