C27H25NO4 — CID 87071558
[[1-(4-benzoylphenyl)-1-oxoheptan-2-ylidene]amino] benzoate (PubChem CID 87071558) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is [[1-(4-benzoylphenyl)-1-oxoheptan-2-ylidene]amino] benzoate.
| Compound Name | [[1-(4-benzoylphenyl)-1-oxoheptan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 87071558 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | [[1-(4-benzoylphenyl)-1-oxoheptan-2-ylidene]amino] benzoate |
| SMILES | CCCCCC(=NOC(=O)c1ccccc1)C(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25NO4/c1-2-3-6-15-24(28-32-27(31)23-13-9-5-10-14-23)26(30)22-18-16-21(17-19-22)25(29)20-11-7-4-8-12-20/h4-5,7-14,16-19H,2-3,6,15H2,1H3 |
| InChIKey | RWNRUAWGCOTIMM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|