C26H23N3O7 — CID 118054184
[(Z)-[1-[4-(2,4-dinitrophenyl)phenyl]-1-oxoheptan-2-ylidene]amino] benzoate (PubChem CID 118054184) has the molecular formula C26H23N3O7 and a molecular weight of 489.48 g/mol. Its IUPAC name is [(Z)-[1-[4-(2,4-dinitrophenyl)phenyl]-1-oxoheptan-2-ylidene]amino] benzoate.
| Compound Name | [(Z)-[1-[4-(2,4-dinitrophenyl)phenyl]-1-oxoheptan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 118054184 |
| Molecular Formula | C26H23N3O7 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | [(Z)-[1-[4-(2,4-dinitrophenyl)phenyl]-1-oxoheptan-2-ylidene]amino] benzoate |
| SMILES | CCCCC/C(=N/OC(=O)c1ccccc1)C(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H23N3O7/c1-2-3-5-10-23(27-36-26(31)20-8-6-4-7-9-20)25(30)19-13-11-18(12-14-19)22-16-15-21(28(32)33)17-24(22)29(34)35/h4,6-9,11-17H,2-3,5,10H2,1H3/b27-23- |
| InChIKey | CQIMNVBBNXFHBR-VYIQYICTSA-N |
| XLogP | 6.15 |
| TPSA | 142.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|