C25H25NO3S — CID 174717450
[[1-oxo-1-(4-thiophen-3-ylphenyl)octan-2-ylidene]amino] benzoate (PubChem CID 174717450) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is [[1-oxo-1-(4-thiophen-3-ylphenyl)octan-2-ylidene]amino] benzoate.
| Compound Name | [[1-oxo-1-(4-thiophen-3-ylphenyl)octan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 174717450 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [[1-oxo-1-(4-thiophen-3-ylphenyl)octan-2-ylidene]amino] benzoate |
| SMILES | CCCCCCC(=NOC(=O)c1ccccc1)C(=O)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-2-3-4-8-11-23(26-29-25(28)21-9-6-5-7-10-21)24(27)20-14-12-19(13-15-20)22-16-17-30-18-22/h5-7,9-10,12-18H,2-4,8,11H2,1H3 |
| InChIKey | AUFXSBQKMZVUPR-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|