C28H29NO3S — CID 146700353
[[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino]methyl benzoate (PubChem CID 146700353) has the molecular formula C28H29NO3S and a molecular weight of 459.61 g/mol. Its IUPAC name is [[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino]methyl benzoate.
| Compound Name | [[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino]methyl benzoate |
|---|---|
| PubChem CID | 146700353 |
| Molecular Formula | C28H29NO3S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | [[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino]methyl benzoate |
| SMILES | CCCCCCC(=NCOC(=O)c1ccccc1)C(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C28H29NO3S/c1-2-3-4-11-16-26(29-21-32-28(31)23-12-7-5-8-13-23)27(30)22-17-19-25(20-18-22)33-24-14-9-6-10-15-24/h5-10,12-15,17-20H,2-4,11,16,21H2,1H3 |
| InChIKey | QTIMZJFXBFSERM-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|