C38H38ClNO2S2 — CID 123751351
[[5-(4-chlorophenyl)sulfanyl-2-[4-[4-(1-phenylethenyl)phenyl]sulfanylphenyl]pent-1-en-3-ylidene]amino]methyl hexanoate (PubChem CID 123751351) has the molecular formula C38H38ClNO2S2 and a molecular weight of 640.31 g/mol. Its IUPAC name is [[5-(4-chlorophenyl)sulfanyl-2-[4-[4-(1-phenylethenyl)phenyl]sulfanylphenyl]pent-1-en-3-ylidene]amino]methyl hexanoate.
| Compound Name | [[5-(4-chlorophenyl)sulfanyl-2-[4-[4-(1-phenylethenyl)phenyl]sulfanylphenyl]pent-1-en-3-ylidene]amino]methyl hexanoate |
|---|---|
| PubChem CID | 123751351 |
| Molecular Formula | C38H38ClNO2S2 |
| Molecular Weight | 640.31 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | [[5-(4-chlorophenyl)sulfanyl-2-[4-[4-(1-phenylethenyl)phenyl]sulfanylphenyl]pent-1-en-3-ylidene]amino]methyl hexanoate |
| SMILES | C=C(C(CCSc1ccc(Cl)cc1)=NCOC(=O)CCCCC)c1ccc(Sc2ccc(C(=C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C38H38ClNO2S2/c1-4-5-7-12-38(41)42-27-40-37(25-26-43-34-23-17-33(39)18-24-34)29(3)32-15-21-36(22-16-32)44-35-19-13-31(14-20-35)28(2)30-10-8-6-9-11-30/h6,8-11,13-24H,2-5,7,12,25-27H2,1H3 |
| InChIKey | QQJIMPFZQWPWRP-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.31 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|