C33H30ClNO2S2 — CID 118281972
4-[[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanylbutylidene]amino]butan-2-one (PubChem CID 118281972) has the molecular formula C33H30ClNO2S2 and a molecular weight of 572.20 g/mol. Its IUPAC name is 4-[[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanylbutylidene]amino]butan-2-one.
| Compound Name | 4-[[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanylbutylidene]amino]butan-2-one |
|---|---|
| PubChem CID | 118281972 |
| Molecular Formula | C33H30ClNO2S2 |
| Molecular Weight | 572.20 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 4-[[1-[4-(4-benzoylphenyl)sulfanylphenyl]-4-(4-chlorophenyl)sulfanylbutylidene]amino]butan-2-one |
| SMILES | CC(=O)CC/N=C(\CCCSc1ccc(Cl)cc1)c1ccc(Sc2ccc(C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H30ClNO2S2/c1-24(36)21-22-35-32(8-5-23-38-29-19-13-28(34)14-20-29)25-9-15-30(16-10-25)39-31-17-11-27(12-18-31)33(37)26-6-3-2-4-7-26/h2-4,6-7,9-20H,5,8,21-23H2,1H3/b35-32+ |
| InChIKey | XHMIJYHHTABAFB-LVYIWIAJSA-N |
| XLogP | 9.06 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.20 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|