C26H24ClNO2S2 — CID 58122023
[(E)-[(E)-6-(4-chlorophenyl)sulfanyl-1-(4-phenylsulfanylphenyl)hex-4-enylidene]amino] acetate (PubChem CID 58122023) has the molecular formula C26H24ClNO2S2 and a molecular weight of 482.07 g/mol. Its IUPAC name is [(E)-[(E)-6-(4-chlorophenyl)sulfanyl-1-(4-phenylsulfanylphenyl)hex-4-enylidene]amino] acetate.
| Compound Name | [(E)-[(E)-6-(4-chlorophenyl)sulfanyl-1-(4-phenylsulfanylphenyl)hex-4-enylidene]amino] acetate |
|---|---|
| PubChem CID | 58122023 |
| Molecular Formula | C26H24ClNO2S2 |
| Molecular Weight | 482.07 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [(E)-[(E)-6-(4-chlorophenyl)sulfanyl-1-(4-phenylsulfanylphenyl)hex-4-enylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\CC/C=C/CSc1ccc(Cl)cc1)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24ClNO2S2/c1-20(29)30-28-26(10-6-3-7-19-31-23-17-13-22(27)14-18-23)21-11-15-25(16-12-21)32-24-8-4-2-5-9-24/h2-5,7-9,11-18H,6,10,19H2,1H3/b7-3+,28-26+ |
| InChIKey | UZEKKGFPZSOUCQ-RCSZLKAGSA-N |
| XLogP | 7.89 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.07 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|