C22H23NO5S — CID 172983820
propan-2-yl (4E)-4-acetyloxyimino-5-oxo-5-(4-phenylsulfanylphenyl)pentanoate (PubChem CID 172983820) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is propan-2-yl (4E)-4-acetyloxyimino-5-oxo-5-(4-phenylsulfanylphenyl)pentanoate.
| Compound Name | propan-2-yl (4E)-4-acetyloxyimino-5-oxo-5-(4-phenylsulfanylphenyl)pentanoate |
|---|---|
| PubChem CID | 172983820 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | propan-2-yl (4E)-4-acetyloxyimino-5-oxo-5-(4-phenylsulfanylphenyl)pentanoate |
| SMILES | CC(=O)O/N=C(\CCC(=O)OC(C)C)C(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO5S/c1-15(2)27-21(25)14-13-20(23-28-16(3)24)22(26)17-9-11-19(12-10-17)29-18-7-5-4-6-8-18/h4-12,15H,13-14H2,1-3H3/b23-20+ |
| InChIKey | KJLFEXRKRNLWNX-BSYVCWPDSA-N |
| XLogP | 4.67 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|