C25H23NO5S — CID 58283554
[(E)-[1-[4-[4-(2-hydroxy-2-phenylethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate (PubChem CID 58283554) has the molecular formula C25H23NO5S and a molecular weight of 449.53 g/mol. Its IUPAC name is [(E)-[1-[4-[4-(2-hydroxy-2-phenylethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[4-[4-(2-hydroxy-2-phenylethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 58283554 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | [(E)-[1-[4-[4-(2-hydroxy-2-phenylethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\C)C(=O)c1ccc(Sc2ccc(OCC(O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H23NO5S/c1-17(26-31-18(2)27)25(29)20-8-12-22(13-9-20)32-23-14-10-21(11-15-23)30-16-24(28)19-6-4-3-5-7-19/h3-15,24,28H,16H2,1-2H3/b26-17+ |
| InChIKey | JCKQGLXGYYUXIG-YZSQISJMSA-N |
| XLogP | 5.07 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|