C37H29NO3S — CID 151597187
[[1-[7-(4-methylphenyl)sulfanyl-9,9-diphenylfluoren-2-yl]-1-oxopropan-2-ylidene]amino] acetate (PubChem CID 151597187) has the molecular formula C37H29NO3S and a molecular weight of 567.71 g/mol. Its IUPAC name is [[1-[7-(4-methylphenyl)sulfanyl-9,9-diphenylfluoren-2-yl]-1-oxopropan-2-ylidene]amino] acetate.
| Compound Name | [[1-[7-(4-methylphenyl)sulfanyl-9,9-diphenylfluoren-2-yl]-1-oxopropan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 151597187 |
| Molecular Formula | C37H29NO3S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | [[1-[7-(4-methylphenyl)sulfanyl-9,9-diphenylfluoren-2-yl]-1-oxopropan-2-ylidene]amino] acetate |
| SMILES | CC(=O)ON=C(C)C(=O)c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cc(Sc3ccc(C)cc3)ccc1-2 |
| InChI | InChI=1S/C37H29NO3S/c1-24-14-17-30(18-15-24)42-31-19-21-33-32-20-16-27(36(40)25(2)38-41-26(3)39)22-34(32)37(35(33)23-31,28-10-6-4-7-11-28)29-12-8-5-9-13-29/h4-23H,1-3H3 |
| InChIKey | QJSCQIBWLLNCRB-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|