C33H29NO3S2 — CID 151020553
[[1-[9,9-dimethyl-2,7-bis(phenylsulfanyl)fluoren-3-yl]-1-oxobutan-2-ylidene]amino] acetate (PubChem CID 151020553) has the molecular formula C33H29NO3S2 and a molecular weight of 551.73 g/mol. Its IUPAC name is [[1-[9,9-dimethyl-2,7-bis(phenylsulfanyl)fluoren-3-yl]-1-oxobutan-2-ylidene]amino] acetate.
| Compound Name | [[1-[9,9-dimethyl-2,7-bis(phenylsulfanyl)fluoren-3-yl]-1-oxobutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 151020553 |
| Molecular Formula | C33H29NO3S2 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | [[1-[9,9-dimethyl-2,7-bis(phenylsulfanyl)fluoren-3-yl]-1-oxobutan-2-ylidene]amino] acetate |
| SMILES | CCC(=NOC(C)=O)C(=O)c1cc2c(cc1Sc1ccccc1)C(C)(C)c1cc(Sc3ccccc3)ccc1-2 |
| InChI | InChI=1S/C33H29NO3S2/c1-5-30(34-37-21(2)35)32(36)27-19-26-25-17-16-24(38-22-12-8-6-9-13-22)18-28(25)33(3,4)29(26)20-31(27)39-23-14-10-7-11-15-23/h6-20H,5H2,1-4H3 |
| InChIKey | LXZCHJGGAZHBSR-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|